EA-3148

EA-3148

Names
IUPAC name O-cyclopentyl S-(2-diethylaminoethyl) methylphosphonothiolate
Identifiers
CAS Number	93240-66-5 Y
ChemSpider	486530 N
Jmol 3D model	Interactive image
PubChem	559673
InChI InChI=1S/C12H26NO2PS/c1-4-13(5-2)10-11-17-16(3,14)15-12-8-6-7-9-12/h12H,4-11H2,1-3H3 N Key: PMVOUPZOZITGTQ-UHFFFAOYSA-N N InChI=1/C12H26NO2PS/c1-4-13(5-2)10-11-17-16(3,14)15-12-8-6-7-9-12/h12H,4-11H2,1-3H3 Key: PMVOUPZOZITGTQ-UHFFFAOYAC
SMILES CCN(CC)CCSP(C)(=O)OC1CCCC1
Properties
Chemical formula	C12H26NO2PS
Molar mass	279.378 g/mol
Density	1.05 g/mL
Boiling point	111.11 °C (232.00 °F; 384.26 K)
Vapor pressure	{{{value}}}
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
N verify (what is YN ?)
Infobox references

EA-3148 (Substance 100A) is a "V-series" nerve agent related to the better-known compounds VX and VR. It was studied by both the US and Soviet chemical weapons programmes during the Cold War, and is notable as the only nerve agent specifically identified in public domain sources as having a higher absolute potency as an acetylcholinesterase inhibitor than VX (around 50% more potent by weight). However, both the US and Soviet investigations of the compound concluded that despite its high potency, the physicochemical properties of the substance made it unsuitable for weaponisation, and further research was not conducted. The chemical structure of EA-3148 falls within the scope of compounds designated "Toxic chemicals" under Schedule 1 of the Chemical Weapons Convention and so it is illegal throughout the world under international law and may only be used for certain types of scientific and medical research.