Fusaric acid

Fusaric acid

Names
IUPAC name 5-Butylpyridine-2-carboxylic acid
Other names 5-Butylpicolinic acid Fusarinic acid Picolinic acid, 5-butyl-
Identifiers
CAS Number	536-69-6 Y
ChemSpider	3324 N
EC Number	208-643-0
Jmol 3D model	Interactive image
KEGG	C10146 N
MeSH	D005669
PubChem	3442
InChI InChI=1S/C10H13NO2/c1-2-3-4-8-5-6-9(10(12)13)11-7-8/h5-7H,2-4H2,1H3,(H,12,13) N Key: DGMPVYSXXIOGJY-UHFFFAOYSA-N N InChI=1/C10H13NO2/c1-2-3-4-8-5-6-9(10(12)13)11-7-8/h5-7H,2-4H2,1H3,(H,12,13) Key: DGMPVYSXXIOGJY-UHFFFAOYAD
SMILES CCCCC1=CN=C(C=C1)C(=O)O
Properties
Chemical formula	C10H13NO2
Molar mass	179.22 g·mol−1
Melting point	97 to 98 °C (207 to 208 °F; 370 to 371 K)
Vapor pressure	{{{value}}}
Related compounds
Related compounds	picolinic acid
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
N verify (what is YN ?)
Infobox references

Fusaric acid is a picolinic acid derivative.

Antibiotic (wilting agent) first isolated from the fungus Fusarium heterosporium.

It is typically isolated from various Fusarium species, and has been proposed for a various therapeutic applications. However, it is primarily used as a research tool.

Its mechanism of action is not well understood. It likely inhibits Dopamine beta-hydroxylase (the enzyme that converts dopamine to norepinephrine). It may also have other actions, such as the inhibition of cell proliferation and DNA synthesis.

It is used to make bupicomide.