Picryl chloride

Picryl chloride

150px
Names
IUPAC name 2-Chloro-1,3,5-trinitrobenzene
Other names 2,4,6-Trinitrochlorobenzene
Identifiers
CAS Number	88-88-0 Y
ChemSpider	6687
Jmol 3D model	Interactive image
PubChem	6953
UN number	0155; 3365 (wetted)
InChI InChI=1S/C6H2ClN3O6/c7-6-4(9(13)14)1-3(8(11)12)2-5(6)10(15)16/h1-2H Key: HJRJRUMKQCMYDL-UHFFFAOYSA-N InChI=1/C6H2ClN3O6/c7-6-4(9(13)14)1-3(8(11)12)2-5(6)10(15)16/h1-2H Key: HJRJRUMKQCMYDL-UHFFFAOYAU
SMILES C1=C(C=C(C(=C1[N+](=O)[O-])Cl)[N+](=O)[O-])[N+](=O)[O-]
Properties
Chemical formula	C6H2ClN3O6
Molar mass	247.55 g/mol
Vapor pressure	{{{value}}}
Explosive data
Detonation velocity	7,200 m/s
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
Y verify (what is YN ?)
Infobox references

Picryl chloride is an explosive also known as 2-chloro-1,3,5-trinitrobenzene or 2,4,6-trinitrochlorobenzene (TNCB). Its empirical formula is C₆H₂ClN₃O₆. Its detonation velocity is 7,200 m/s.

Chemistry

Picryl chloride is known to have formed crystals such as that of the picryl chloride and hexamethylbenzene in a 1:1 ratio, forming orthorhombic, orange-yellow crystals.