Bicinchoninic acid

Bicinchoninic acid

200px
Names
IUPAC name 2-(4-Carboxyquinolin-2-yl)quinoline-4-carboxylic acid
Other names Bicinchoninic acid 4,4'-Dicarboxy-2,2'-biquinoline
Identifiers
CAS Number	1245-13-2 Y
ChEMBL	ChEMBL431482 Y
ChemSpider	64223 Y
Jmol 3D model	Interactive image
PubChem	71068
InChI InChI=1S/C20H12N2O4/c23-19(24)13-9-17(21-15-7-3-1-5-11(13)15)18-10-14(20(25)26)12-6-2-4-8-16(12)22-18/h1-10H,(H,23,24)(H,25,26) Y Key: AFYNADDZULBEJA-UHFFFAOYSA-N Y InChI=1/C20H12N2O4/c23-19(24)13-9-17(21-15-7-3-1-5-11(13)15)18-10-14(20(25)26)12-6-2-4-8-16(12)22-18/h1-10H,(H,23,24)(H,25,26) Key: AFYNADDZULBEJA-UHFFFAOYAF
SMILES O=C(O)c1cc(nc2c1cccc2)c3nc4ccccc4c(c3)C(=O)O
Properties
Chemical formula	C20H12N2O4
Molar mass	344.33 g·mol−1
Appearance	Cream colored powder
Odor	Characteristic odor
Melting point	365 to 367 °C (689 to 693 °F; 638 to 640 K)
Solubility in water	Partially soluble in cold water, hot water
Vapor pressure	{{{value}}}
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
Y verify (what is YN ?)
Infobox references

Bicinchoninic acid is a weak acid composed of two carboxylated quinoline rings.

Bicinchoninic acid is most commonly employed by biochemists in the bicinchoninic acid (BCA) assay, which is used to determine the total level of protein in a solution. In this assay, two molecules of bicinchoninic acid chelate a single Cu⁺ ion, forming a purple water-soluble complex that strongly absorbs light at 562 nm.